C23H26ClNO3 — CID 170893088
2-amino-3-[3,4-bis(phenylmethoxy)phenyl]propan-1-ol;hydrochloride (PubChem CID 170893088) has the molecular formula C23H26ClNO3 and a molecular weight of 399.92 g/mol. Its IUPAC name is 2-amino-3-[3,4-bis(phenylmethoxy)phenyl]propan-1-ol;hydrochloride.
| Compound Name | 2-amino-3-[3,4-bis(phenylmethoxy)phenyl]propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 170893088 |
| Molecular Formula | C23H26ClNO3 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-amino-3-[3,4-bis(phenylmethoxy)phenyl]propan-1-ol;hydrochloride |
| SMILES | Cl.NC(CO)Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO3.ClH/c24-21(15-25)13-20-11-12-22(26-16-18-7-3-1-4-8-18)23(14-20)27-17-19-9-5-2-6-10-19;/h1-12,14,21,25H,13,15-17,24H2;1H |
| InChIKey | ZZIMATRNUILZNM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |