C21H26O6 — CID 71574866
[(2R)-2-(hydroxymethyl)-3-[4-(methoxymethoxy)-3-phenylmethoxyphenyl]propyl] acetate (PubChem CID 71574866) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is [(2R)-2-(hydroxymethyl)-3-[4-(methoxymethoxy)-3-phenylmethoxyphenyl]propyl] acetate.
| Compound Name | [(2R)-2-(hydroxymethyl)-3-[4-(methoxymethoxy)-3-phenylmethoxyphenyl]propyl] acetate |
|---|---|
| PubChem CID | 71574866 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [(2R)-2-(hydroxymethyl)-3-[4-(methoxymethoxy)-3-phenylmethoxyphenyl]propyl] acetate |
| SMILES | COCOc1ccc(C[C@H](CO)COC(C)=O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H26O6/c1-16(23)25-14-19(12-22)10-18-8-9-20(27-15-24-2)21(11-18)26-13-17-6-4-3-5-7-17/h3-9,11,19,22H,10,12-15H2,1-2H3/t19-/m1/s1 |
| InChIKey | XNQKUXKDYYZCFQ-LJQANCHMSA-N |
| XLogP | 2.96 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|