C37H35NO4 — CID 146659614
3-[3,4-bis(phenylmethoxy)phenyl]-2-(dibenzylamino)propanoic acid (PubChem CID 146659614) has the molecular formula C37H35NO4 and a molecular weight of 557.69 g/mol. Its IUPAC name is 3-[3,4-bis(phenylmethoxy)phenyl]-2-(dibenzylamino)propanoic acid.
| Compound Name | 3-[3,4-bis(phenylmethoxy)phenyl]-2-(dibenzylamino)propanoic acid |
|---|---|
| PubChem CID | 146659614 |
| Molecular Formula | C37H35NO4 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.26 |
| IUPAC Name | 3-[3,4-bis(phenylmethoxy)phenyl]-2-(dibenzylamino)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C37H35NO4/c39-37(40)34(38(25-29-13-5-1-6-14-29)26-30-15-7-2-8-16-30)23-33-21-22-35(41-27-31-17-9-3-10-18-31)36(24-33)42-28-32-19-11-4-12-20-32/h1-22,24,34H,23,25-28H2,(H,39,40) |
| InChIKey | BWWKYSCLMYRZCX-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |