C40H47NO5Si — CID 11990958
2-trimethylsilylethyl (Z)-2-[5-[(2S)-2-(dibenzylamino)-3-methoxy-3-oxopropyl]-2-phenylmethoxyphenyl]but-2-enoate (PubChem CID 11990958) has the molecular formula C40H47NO5Si and a molecular weight of 649.90 g/mol. Its IUPAC name is 2-trimethylsilylethyl (Z)-2-[5-[(2S)-2-(dibenzylamino)-3-methoxy-3-oxopropyl]-2-phenylmethoxyphenyl]but-2-enoate.
| Compound Name | 2-trimethylsilylethyl (Z)-2-[5-[(2S)-2-(dibenzylamino)-3-methoxy-3-oxopropyl]-2-phenylmethoxyphenyl]but-2-enoate |
|---|---|
| PubChem CID | 11990958 |
| Molecular Formula | C40H47NO5Si |
| Molecular Weight | 649.90 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | 2-trimethylsilylethyl (Z)-2-[5-[(2S)-2-(dibenzylamino)-3-methoxy-3-oxopropyl]-2-phenylmethoxyphenyl]but-2-enoate |
| SMILES | C/C=C(\C(=O)OCC[Si](C)(C)C)c1cc(C[C@@H](C(=O)OC)N(Cc2ccccc2)Cc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C40H47NO5Si/c1-6-35(39(42)45-24-25-47(3,4)5)36-26-34(22-23-38(36)46-30-33-20-14-9-15-21-33)27-37(40(43)44-2)41(28-31-16-10-7-11-17-31)29-32-18-12-8-13-19-32/h6-23,26,37H,24-25,27-30H2,1-5H3/b35-6-/t37-/m0/s1 |
| InChIKey | XTXFSARIISIPLV-WREKCDELSA-N |
| XLogP | 8.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.90 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|