C21H25NO2 — CID 59990290
methyl (2S)-2-[benzyl(but-3-enyl)amino]-3-phenylpropanoate (PubChem CID 59990290) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl(but-3-enyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[benzyl(but-3-enyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 59990290 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | methyl (2S)-2-[benzyl(but-3-enyl)amino]-3-phenylpropanoate |
| SMILES | C=CCCN(Cc1ccccc1)[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C21H25NO2/c1-3-4-15-22(17-19-13-9-6-10-14-19)20(21(23)24-2)16-18-11-7-5-8-12-18/h3,5-14,20H,1,4,15-17H2,2H3/t20-/m0/s1 |
| InChIKey | HFDXWHPSHBBVEN-FQEVSTJZSA-N |
| XLogP | 3.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|