C26H32N2O5P+ — CID 15499310
bis[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-prop-2-enylamino]-oxophosphanium (PubChem CID 15499310) has the molecular formula C26H32N2O5P+ and a molecular weight of 483.53 g/mol. Its IUPAC name is bis[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-prop-2-enylamino]-oxophosphanium.
| Compound Name | bis[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-prop-2-enylamino]-oxophosphanium |
|---|---|
| PubChem CID | 15499310 |
| Molecular Formula | C26H32N2O5P+ |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | bis[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]-prop-2-enylamino]-oxophosphanium |
| SMILES | C=CCN([C@@H](Cc1ccccc1)C(=O)OC)[P+](=O)N(CC=C)[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C26H32N2O5P/c1-5-17-27(23(25(29)32-3)19-21-13-9-7-10-14-21)34(31)28(18-6-2)24(26(30)33-4)20-22-15-11-8-12-16-22/h5-16,23-24H,1-2,17-20H2,3-4H3/q+1/t23-,24-/m0/s1 |
| InChIKey | DAYGNGGEHOUBPD-ZEQRLZLVSA-N |
| XLogP | 4.19 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|