C21H25NO2S — CID 102329937
methyl (2S)-2-[benzyl(phenylsulfanyl)amino]hept-6-enoate (PubChem CID 102329937) has the molecular formula C21H25NO2S and a molecular weight of 355.50 g/mol. Its IUPAC name is methyl (2S)-2-[benzyl(phenylsulfanyl)amino]hept-6-enoate.
| Compound Name | methyl (2S)-2-[benzyl(phenylsulfanyl)amino]hept-6-enoate |
|---|---|
| PubChem CID | 102329937 |
| Molecular Formula | C21H25NO2S |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | methyl (2S)-2-[benzyl(phenylsulfanyl)amino]hept-6-enoate |
| SMILES | C=CCCC[C@@H](C(=O)OC)N(Cc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C21H25NO2S/c1-3-4-7-16-20(21(23)24-2)22(17-18-12-8-5-9-13-18)25-19-14-10-6-11-15-19/h3,5-6,8-15,20H,1,4,7,16-17H2,2H3/t20-/m0/s1 |
| InChIKey | GOQAFVVZTAVKIP-FQEVSTJZSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|