C26H35NO2 — CID 102070944
methyl (2S)-2-[(R)-(benzylamino)-phenylmethyl]undec-10-enoate (PubChem CID 102070944) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is methyl (2S)-2-[(R)-(benzylamino)-phenylmethyl]undec-10-enoate.
| Compound Name | methyl (2S)-2-[(R)-(benzylamino)-phenylmethyl]undec-10-enoate |
|---|---|
| PubChem CID | 102070944 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | methyl (2S)-2-[(R)-(benzylamino)-phenylmethyl]undec-10-enoate |
| SMILES | C=CCCCCCCC[C@H](C(=O)OC)[C@@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H35NO2/c1-3-4-5-6-7-8-15-20-24(26(28)29-2)25(23-18-13-10-14-19-23)27-21-22-16-11-9-12-17-22/h3,9-14,16-19,24-25,27H,1,4-8,15,20-21H2,2H3/t24-,25-/m0/s1 |
| InChIKey | JVUHKKUMPJIZQD-DQEYMECFSA-N |
| XLogP | 6.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|