C26H35NO2 — CID 134901382
[6-[(benzylamino)-phenylmethyl]-3,7-dimethyloct-7-enyl] acetate (PubChem CID 134901382) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is [6-[(benzylamino)-phenylmethyl]-3,7-dimethyloct-7-enyl] acetate.
| Compound Name | [6-[(benzylamino)-phenylmethyl]-3,7-dimethyloct-7-enyl] acetate |
|---|---|
| PubChem CID | 134901382 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | [6-[(benzylamino)-phenylmethyl]-3,7-dimethyloct-7-enyl] acetate |
| SMILES | C=C(C)C(CCC(C)CCOC(C)=O)C(NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H35NO2/c1-20(2)25(16-15-21(3)17-18-29-22(4)28)26(24-13-9-6-10-14-24)27-19-23-11-7-5-8-12-23/h5-14,21,25-27H,1,15-19H2,2-4H3 |
| InChIKey | BNBGGCIRRBNDGO-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|