C21H25NO2 — CID 102397500
4-[(benzylamino)-phenylmethyl]heptane-3,5-dione (PubChem CID 102397500) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-[(benzylamino)-phenylmethyl]heptane-3,5-dione.
| Compound Name | 4-[(benzylamino)-phenylmethyl]heptane-3,5-dione |
|---|---|
| PubChem CID | 102397500 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 4-[(benzylamino)-phenylmethyl]heptane-3,5-dione |
| SMILES | CCC(=O)C(C(=O)CC)C(NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-3-18(23)20(19(24)4-2)21(17-13-9-6-10-14-17)22-15-16-11-7-5-8-12-16/h5-14,20-22H,3-4,15H2,1-2H3 |
| InChIKey | LMXBTQVVHLPLBT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|