C16H17NO3 — CID 18655941
(2R,3S)-3-(benzylamino)-2-hydroxy-3-phenylpropanoic acid (PubChem CID 18655941) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is (2R,3S)-3-(benzylamino)-2-hydroxy-3-phenylpropanoic acid.
| Compound Name | (2R,3S)-3-(benzylamino)-2-hydroxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 18655941 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (2R,3S)-3-(benzylamino)-2-hydroxy-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](O)[C@@H](NCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17NO3/c18-15(16(19)20)14(13-9-5-2-6-10-13)17-11-12-7-3-1-4-8-12/h1-10,14-15,17-18H,11H2,(H,19,20)/t14-,15+/m0/s1 |
| InChIKey | IDKGOWNLIAJLAU-LSDHHAIUSA-N |
| XLogP | 1.96 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |