C20H23NO2 — CID 89259441
prop-1-en-2-yl 2-[(4-ethylphenyl)methylamino]-2-phenylacetate (PubChem CID 89259441) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is prop-1-en-2-yl 2-[(4-ethylphenyl)methylamino]-2-phenylacetate.
| Compound Name | prop-1-en-2-yl 2-[(4-ethylphenyl)methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 89259441 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | prop-1-en-2-yl 2-[(4-ethylphenyl)methylamino]-2-phenylacetate |
| SMILES | C=C(C)OC(=O)C(NCc1ccc(CC)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-4-16-10-12-17(13-11-16)14-21-19(20(22)23-15(2)3)18-8-6-5-7-9-18/h5-13,19,21H,2,4,14H2,1,3H3 |
| InChIKey | DAFWPBOCBNUIFI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|