C21H26FNO2 — CID 71192085
tert-butyl 2-[(4-ethyl-2-fluorophenyl)methylamino]-2-phenylacetate (PubChem CID 71192085) has the molecular formula C21H26FNO2 and a molecular weight of 343.44 g/mol. Its IUPAC name is tert-butyl 2-[(4-ethyl-2-fluorophenyl)methylamino]-2-phenylacetate.
| Compound Name | tert-butyl 2-[(4-ethyl-2-fluorophenyl)methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 71192085 |
| Molecular Formula | C21H26FNO2 |
| Molecular Weight | 343.44 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | tert-butyl 2-[(4-ethyl-2-fluorophenyl)methylamino]-2-phenylacetate |
| SMILES | CCc1ccc(CNC(C(=O)OC(C)(C)C)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C21H26FNO2/c1-5-15-11-12-17(18(22)13-15)14-23-19(16-9-7-6-8-10-16)20(24)25-21(2,3)4/h6-13,19,23H,5,14H2,1-4H3 |
| InChIKey | CMLAIULENOGRTN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |