C27H30O2P+ — CID 101240763
(1-methoxy-1-oxooct-7-en-2-yl)-triphenylphosphanium (PubChem CID 101240763) has the molecular formula C27H30O2P+ and a molecular weight of 417.51 g/mol. Its IUPAC name is (1-methoxy-1-oxooct-7-en-2-yl)-triphenylphosphanium.
| Compound Name | (1-methoxy-1-oxooct-7-en-2-yl)-triphenylphosphanium |
|---|---|
| PubChem CID | 101240763 |
| Molecular Formula | C27H30O2P+ |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | (1-methoxy-1-oxooct-7-en-2-yl)-triphenylphosphanium |
| SMILES | C=CCCCCC(C(=O)OC)[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O2P/c1-3-4-5-15-22-26(27(28)29-2)30(23-16-9-6-10-17-23,24-18-11-7-12-19-24)25-20-13-8-14-21-25/h3,6-14,16-21,26H,1,4-5,15,22H2,2H3/q+1 |
| InChIKey | BSCVPXZCGKGKNP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|