C24H27NO4 — CID 138544790
(2S)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]non-8-enoic acid (PubChem CID 138544790) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (2S)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]non-8-enoic acid.
| Compound Name | (2S)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]non-8-enoic acid |
|---|---|
| PubChem CID | 138544790 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (2S)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]non-8-enoic acid |
| SMILES | C=CCCCCC[C@@H](C(=O)O)N(C(=O)OC)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H27NO4/c1-3-4-5-6-7-16-21(23(26)27)25(24(28)29-2)22-19-14-10-8-12-17(19)18-13-9-11-15-20(18)22/h3,8-15,21-22H,1,4-7,16H2,2H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | ABJZMLISZXVTPR-NRFANRHFSA-N |
| XLogP | 5.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|