C26H21NO4S — CID 68886027
(2R)-3-(1-benzothiophen-3-yl)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]propanoic acid (PubChem CID 68886027) has the molecular formula C26H21NO4S and a molecular weight of 443.52 g/mol. Its IUPAC name is (2R)-3-(1-benzothiophen-3-yl)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]propanoic acid.
| Compound Name | (2R)-3-(1-benzothiophen-3-yl)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 68886027 |
| Molecular Formula | C26H21NO4S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (2R)-3-(1-benzothiophen-3-yl)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]propanoic acid |
| SMILES | COC(=O)N(C1c2ccccc2-c2ccccc21)[C@H](Cc1csc2ccccc12)C(=O)O |
| InChI | InChI=1S/C26H21NO4S/c1-31-26(30)27(22(25(28)29)14-16-15-32-23-13-7-6-8-17(16)23)24-20-11-4-2-9-18(20)19-10-3-5-12-21(19)24/h2-13,15,22,24H,14H2,1H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | KEAODMTYAVKTMZ-JOCHJYFZSA-N |
| XLogP | 5.74 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |