C27H23INO2S- — CID 163641377
N-[(2R)-1-(1-benzothiophen-3-yl)-3-oxobutan-2-yl]-1-(9H-fluoren-9-ylmethyliodanuidyl)formamide (PubChem CID 163641377) has the molecular formula C27H23INO2S- and a molecular weight of 552.46 g/mol. Its IUPAC name is N-[(2R)-1-(1-benzothiophen-3-yl)-3-oxobutan-2-yl]-1-(9H-fluoren-9-ylmethyliodanuidyl)formamide.
| Compound Name | N-[(2R)-1-(1-benzothiophen-3-yl)-3-oxobutan-2-yl]-1-(9H-fluoren-9-ylmethyliodanuidyl)formamide |
|---|---|
| PubChem CID | 163641377 |
| Molecular Formula | C27H23INO2S- |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | N-[(2R)-1-(1-benzothiophen-3-yl)-3-oxobutan-2-yl]-1-(9H-fluoren-9-ylmethyliodanuidyl)formamide |
| SMILES | CC(=O)[C@@H](Cc1csc2ccccc12)NC(=O)[I-]CC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H23INO2S/c1-17(30)25(14-18-16-32-26-13-7-6-8-19(18)26)29-27(31)28-15-24-22-11-4-2-9-20(22)21-10-3-5-12-23(21)24/h2-13,16,24-25H,14-15H2,1H3,(H,29,31)/q-1/t25-/m1/s1 |
| InChIKey | GELXARPZKZXXTD-RUZDIDTESA-N |
| XLogP | 3.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|