C13H13NO2S — CID 87362441
N-[(2R)-1-(1-benzothiophen-3-yl)-3-oxopropan-2-yl]acetamide (PubChem CID 87362441) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is N-[(2R)-1-(1-benzothiophen-3-yl)-3-oxopropan-2-yl]acetamide.
| Compound Name | N-[(2R)-1-(1-benzothiophen-3-yl)-3-oxopropan-2-yl]acetamide |
|---|---|
| PubChem CID | 87362441 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-[(2R)-1-(1-benzothiophen-3-yl)-3-oxopropan-2-yl]acetamide |
| SMILES | CC(=O)N[C@@H](C=O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C13H13NO2S/c1-9(16)14-11(7-15)6-10-8-17-13-5-3-2-4-12(10)13/h2-5,7-8,11H,6H2,1H3,(H,14,16)/t11-/m1/s1 |
| InChIKey | FHCXAXJDUPODED-LLVKDONJSA-N |
| XLogP | 2.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|