C12H12INO2S — CID 166792223
4-(1-benzothiophen-3-yl)-3-(iodoamino)butanoic acid (PubChem CID 166792223) has the molecular formula C12H12INO2S and a molecular weight of 361.20 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-3-(iodoamino)butanoic acid.
| Compound Name | 4-(1-benzothiophen-3-yl)-3-(iodoamino)butanoic acid |
|---|---|
| PubChem CID | 166792223 |
| Molecular Formula | C12H12INO2S |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-3-(iodoamino)butanoic acid |
| SMILES | O=C(O)CC(Cc1csc2ccccc12)NI |
| InChI | InChI=1S/C12H12INO2S/c13-14-9(6-12(15)16)5-8-7-17-11-4-2-1-3-10(8)11/h1-4,7,9,14H,5-6H2,(H,15,16) |
| InChIKey | GSLPQOZKHPNTPP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|