C13H17NS2 — CID 63736738
1-(1-benzothiophen-3-yl)-N-methyl-3-methylsulfanylpropan-2-amine (PubChem CID 63736738) has the molecular formula C13H17NS2 and a molecular weight of 251.42 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-methyl-3-methylsulfanylpropan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-methyl-3-methylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 63736738 |
| Molecular Formula | C13H17NS2 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-methyl-3-methylsulfanylpropan-2-amine |
| SMILES | CNC(CSC)Cc1csc2ccccc12 |
| InChI | InChI=1S/C13H17NS2/c1-14-11(9-15-2)7-10-8-16-13-6-4-3-5-12(10)13/h3-6,8,11,14H,7,9H2,1-2H3 |
| InChIKey | OLUFYJIWTZXXMS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |