C13H19N3S — CID 105244750
3-(1-benzothiophen-3-yl)-2-hydrazinyl-N,N-dimethylpropan-1-amine (PubChem CID 105244750) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-(1-benzothiophen-3-yl)-2-hydrazinyl-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(1-benzothiophen-3-yl)-2-hydrazinyl-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 105244750 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-(1-benzothiophen-3-yl)-2-hydrazinyl-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC(Cc1csc2ccccc12)NN |
| InChI | InChI=1S/C13H19N3S/c1-16(2)8-11(15-14)7-10-9-17-13-6-4-3-5-12(10)13/h3-6,9,11,15H,7-8,14H2,1-2H3 |
| InChIKey | CRRJKWAGCKUOCR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|