C17H24N2S — CID 105291757
[2-(1-benzothiophen-3-yl)-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]hydrazine (PubChem CID 105291757) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is [2-(1-benzothiophen-3-yl)-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]hydrazine.
| Compound Name | [2-(1-benzothiophen-3-yl)-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105291757 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | [2-(1-benzothiophen-3-yl)-1-(2,2,3,3-tetramethylcyclopropyl)ethyl]hydrazine |
| SMILES | CC1(C)C(C(Cc2csc3ccccc23)NN)C1(C)C |
| InChI | InChI=1S/C17H24N2S/c1-16(2)15(17(16,3)4)13(19-18)9-11-10-20-14-8-6-5-7-12(11)14/h5-8,10,13,15,19H,9,18H2,1-4H3 |
| InChIKey | WZJXCTXQAQHRGF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|