C17H20N2OS — CID 105291679
[2-(1-benzothiophen-3-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine (PubChem CID 105291679) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is [2-(1-benzothiophen-3-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine.
| Compound Name | [2-(1-benzothiophen-3-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105291679 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [2-(1-benzothiophen-3-yl)-1-(2,4,5-trimethylfuran-3-yl)ethyl]hydrazine |
| SMILES | Cc1oc(C)c(C(Cc2csc3ccccc23)NN)c1C |
| InChI | InChI=1S/C17H20N2OS/c1-10-11(2)20-12(3)17(10)15(19-18)8-13-9-21-16-7-5-4-6-14(13)16/h4-7,9,15,19H,8,18H2,1-3H3 |
| InChIKey | BGHSULVCABETKE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|