C14H13BrN2S2 — CID 105222485
[2-(1-benzothiophen-3-yl)-1-(4-bromothiophen-2-yl)ethyl]hydrazine (PubChem CID 105222485) has the molecular formula C14H13BrN2S2 and a molecular weight of 353.31 g/mol. Its IUPAC name is [2-(1-benzothiophen-3-yl)-1-(4-bromothiophen-2-yl)ethyl]hydrazine.
| Compound Name | [2-(1-benzothiophen-3-yl)-1-(4-bromothiophen-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105222485 |
| Molecular Formula | C14H13BrN2S2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | [2-(1-benzothiophen-3-yl)-1-(4-bromothiophen-2-yl)ethyl]hydrazine |
| SMILES | NNC(Cc1csc2ccccc12)c1cc(Br)cs1 |
| InChI | InChI=1S/C14H13BrN2S2/c15-10-6-14(19-8-10)12(17-16)5-9-7-18-13-4-2-1-3-11(9)13/h1-4,6-8,12,17H,5,16H2 |
| InChIKey | UKQBYTWHNFVOQY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|