C17H25NS — CID 79412102
1-(1-benzothiophen-3-yl)-N-propan-2-ylhexan-2-amine (PubChem CID 79412102) has the molecular formula C17H25NS and a molecular weight of 275.46 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-propan-2-ylhexan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-propan-2-ylhexan-2-amine |
|---|---|
| PubChem CID | 79412102 |
| Molecular Formula | C17H25NS |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-propan-2-ylhexan-2-amine |
| SMILES | CCCCC(Cc1csc2ccccc12)NC(C)C |
| InChI | InChI=1S/C17H25NS/c1-4-5-8-15(18-13(2)3)11-14-12-19-17-10-7-6-9-16(14)17/h6-7,9-10,12-13,15,18H,4-5,8,11H2,1-3H3 |
| InChIKey | IGVBNQFTUJCYFR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |