C14H19NS — CID 60704533
N-(1-benzothiophen-3-ylmethyl)pentan-2-amine (PubChem CID 60704533) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)pentan-2-amine.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)pentan-2-amine |
|---|---|
| PubChem CID | 60704533 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)pentan-2-amine |
| SMILES | CCCC(C)NCc1csc2ccccc12 |
| InChI | InChI=1S/C14H19NS/c1-3-6-11(2)15-9-12-10-16-14-8-5-4-7-13(12)14/h4-5,7-8,10-11,15H,3,6,9H2,1-2H3 |
| InChIKey | MZIDDMJNKOXINP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |