C15H21NS — CID 62698113
N-(1-benzothiophen-3-ylmethyl)hexan-3-amine (PubChem CID 62698113) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)hexan-3-amine.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)hexan-3-amine |
|---|---|
| PubChem CID | 62698113 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)hexan-3-amine |
| SMILES | CCCC(CC)NCc1csc2ccccc12 |
| InChI | InChI=1S/C15H21NS/c1-3-7-13(4-2)16-10-12-11-17-15-9-6-5-8-14(12)15/h5-6,8-9,11,13,16H,3-4,7,10H2,1-2H3 |
| InChIKey | JKDRQJRTQHYFTR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |