C14H17NS — CID 115633123
N-(1-benzothiophen-3-ylmethyl)pent-4-en-2-amine (PubChem CID 115633123) has the molecular formula C14H17NS and a molecular weight of 231.36 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)pent-4-en-2-amine.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 115633123 |
| Molecular Formula | C14H17NS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)pent-4-en-2-amine |
| SMILES | C=CCC(C)NCc1csc2ccccc12 |
| InChI | InChI=1S/C14H17NS/c1-3-6-11(2)15-9-12-10-16-14-8-5-4-7-13(12)14/h3-5,7-8,10-11,15H,1,6,9H2,2H3 |
| InChIKey | UMMZBBAOWNEBBD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|