C18H27NS — CID 115823570
1-(1-benzothiophen-3-yl)-N-methyl-3-propylhexan-2-amine (PubChem CID 115823570) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-N-methyl-3-propylhexan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-N-methyl-3-propylhexan-2-amine |
|---|---|
| PubChem CID | 115823570 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-N-methyl-3-propylhexan-2-amine |
| SMILES | CCCC(CCC)C(Cc1csc2ccccc12)NC |
| InChI | InChI=1S/C18H27NS/c1-4-8-14(9-5-2)17(19-3)12-15-13-20-18-11-7-6-10-16(15)18/h6-7,10-11,13-14,17,19H,4-5,8-9,12H2,1-3H3 |
| InChIKey | XKLOYQXQOPGAJG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |