C15H21NS — CID 115823990
1-(1-benzothiophen-3-yl)heptan-2-amine (PubChem CID 115823990) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)heptan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)heptan-2-amine |
|---|---|
| PubChem CID | 115823990 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)heptan-2-amine |
| SMILES | CCCCCC(N)Cc1csc2ccccc12 |
| InChI | InChI=1S/C15H21NS/c1-2-3-4-7-13(16)10-12-11-17-15-9-6-5-8-14(12)15/h5-6,8-9,11,13H,2-4,7,10,16H2,1H3 |
| InChIKey | VNDNALRBCSGLHD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|