C18H19NS — CID 63737079
1-(1-benzothiophen-3-yl)-3-(3-methylphenyl)propan-2-amine (PubChem CID 63737079) has the molecular formula C18H19NS and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-(3-methylphenyl)propan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-(3-methylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 63737079 |
| Molecular Formula | C18H19NS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-(3-methylphenyl)propan-2-amine |
| SMILES | Cc1cccc(CC(N)Cc2csc3ccccc23)c1 |
| InChI | InChI=1S/C18H19NS/c1-13-5-4-6-14(9-13)10-16(19)11-15-12-20-18-8-3-2-7-17(15)18/h2-9,12,16H,10-11,19H2,1H3 |
| InChIKey | RWUNNBARCBNVIU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |