C18H19NS2 — CID 66097364
1-(1-benzothiophen-3-yl)-3-(2-methylphenyl)sulfanylpropan-2-amine (PubChem CID 66097364) has the molecular formula C18H19NS2 and a molecular weight of 313.49 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-(2-methylphenyl)sulfanylpropan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-(2-methylphenyl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 66097364 |
| Molecular Formula | C18H19NS2 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-(2-methylphenyl)sulfanylpropan-2-amine |
| SMILES | Cc1ccccc1SCC(N)Cc1csc2ccccc12 |
| InChI | InChI=1S/C18H19NS2/c1-13-6-2-4-8-17(13)21-12-15(19)10-14-11-20-18-9-5-3-7-16(14)18/h2-9,11,15H,10,12,19H2,1H3 |
| InChIKey | NTVBEKDYJIMNOR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |