C15H21NS2 — CID 65135783
1-(1-benzothiophen-3-yl)-3-(2-methylpropylsulfanyl)propan-2-amine (PubChem CID 65135783) has the molecular formula C15H21NS2 and a molecular weight of 279.47 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-(2-methylpropylsulfanyl)propan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-(2-methylpropylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 65135783 |
| Molecular Formula | C15H21NS2 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-(2-methylpropylsulfanyl)propan-2-amine |
| SMILES | CC(C)CSCC(N)Cc1csc2ccccc12 |
| InChI | InChI=1S/C15H21NS2/c1-11(2)8-17-10-13(16)7-12-9-18-15-6-4-3-5-14(12)15/h3-6,9,11,13H,7-8,10,16H2,1-2H3 |
| InChIKey | QLNUOQXCXXHOQC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |