C14H16F3NOS — CID 103147970
1-(1-benzothiophen-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine (PubChem CID 103147970) has the molecular formula C14H16F3NOS and a molecular weight of 303.35 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine |
|---|---|
| PubChem CID | 103147970 |
| Molecular Formula | C14H16F3NOS |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-4-(2,2,2-trifluoroethoxy)butan-2-amine |
| SMILES | NC(CCOCC(F)(F)F)Cc1csc2ccccc12 |
| InChI | InChI=1S/C14H16F3NOS/c15-14(16,17)9-19-6-5-11(18)7-10-8-20-13-4-2-1-3-12(10)13/h1-4,8,11H,5-7,9,18H2 |
| InChIKey | HLCTWBJFKVRGKB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|