C14H15F4NOS — CID 103474741
1-(1-benzothiophen-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine (PubChem CID 103474741) has the molecular formula C14H15F4NOS and a molecular weight of 321.34 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
|---|---|
| PubChem CID | 103474741 |
| Molecular Formula | C14H15F4NOS |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-(2,2,3,3-tetrafluoropropoxy)propan-2-amine |
| SMILES | NC(COCC(F)(F)C(F)F)Cc1csc2ccccc12 |
| InChI | InChI=1S/C14H15F4NOS/c15-13(16)14(17,18)8-20-6-10(19)5-9-7-21-12-4-2-1-3-11(9)12/h1-4,7,10,13H,5-6,8,19H2 |
| InChIKey | FDLWMERRQFAIPW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|