C20H26N4O3S — CID 143400483
N-[(2R)-1-(acetamidomethylamino)-3-(1-benzothiophen-3-yl)-1-oxopropan-2-yl]piperidine-4-carboxamide (PubChem CID 143400483) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[(2R)-1-(acetamidomethylamino)-3-(1-benzothiophen-3-yl)-1-oxopropan-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[(2R)-1-(acetamidomethylamino)-3-(1-benzothiophen-3-yl)-1-oxopropan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 143400483 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[(2R)-1-(acetamidomethylamino)-3-(1-benzothiophen-3-yl)-1-oxopropan-2-yl]piperidine-4-carboxamide |
| SMILES | CC(=O)NCNC(=O)[C@@H](Cc1csc2ccccc12)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C20H26N4O3S/c1-13(25)22-12-23-20(27)17(24-19(26)14-6-8-21-9-7-14)10-15-11-28-18-5-3-2-4-16(15)18/h2-5,11,14,17,21H,6-10,12H2,1H3,(H,22,25)(H,23,27)(H,24,26)/t17-/m1/s1 |
| InChIKey | KPZCDAUKMLPVDK-QGZVFWFLSA-N |
| XLogP | 1.14 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|