C20H25N3O2 — CID 143760622
N-[1-(methylamino)-3-naphthalen-1-yl-1-oxopropan-2-yl]piperidine-4-carboxamide (PubChem CID 143760622) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[1-(methylamino)-3-naphthalen-1-yl-1-oxopropan-2-yl]piperidine-4-carboxamide.
| Compound Name | N-[1-(methylamino)-3-naphthalen-1-yl-1-oxopropan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 143760622 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[1-(methylamino)-3-naphthalen-1-yl-1-oxopropan-2-yl]piperidine-4-carboxamide |
| SMILES | CNC(=O)C(Cc1cccc2ccccc12)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C20H25N3O2/c1-21-20(25)18(23-19(24)15-9-11-22-12-10-15)13-16-7-4-6-14-5-2-3-8-17(14)16/h2-8,15,18,22H,9-13H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | HYGFNVAIMAZIEU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |