C23H28NO8P — CID 87693964
3-(diethoxyphosphorylmethoxy)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]propanoic acid (PubChem CID 87693964) has the molecular formula C23H28NO8P and a molecular weight of 477.45 g/mol. Its IUPAC name is 3-(diethoxyphosphorylmethoxy)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]propanoic acid.
| Compound Name | 3-(diethoxyphosphorylmethoxy)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 87693964 |
| Molecular Formula | C23H28NO8P |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 3-(diethoxyphosphorylmethoxy)-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]propanoic acid |
| SMILES | CCOP(=O)(COCC(C(=O)O)N(C(=O)OC)C1c2ccccc2-c2ccccc21)OCC |
| InChI | InChI=1S/C23H28NO8P/c1-4-31-33(28,32-5-2)15-30-14-20(22(25)26)24(23(27)29-3)21-18-12-8-6-10-16(18)17-11-7-9-13-19(17)21/h6-13,20-21H,4-5,14-15H2,1-3H3,(H,25,26) |
| InChIKey | VQZPGBPPOJBBQU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|