C35H39Cl2N3O7 — CID 68958422
6-[6-[[2-(2,4-dichlorophenoxy)acetyl]amino]hexanoylamino]-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]hexanoic acid (PubChem CID 68958422) has the molecular formula C35H39Cl2N3O7 and a molecular weight of 684.62 g/mol. Its IUPAC name is 6-[6-[[2-(2,4-dichlorophenoxy)acetyl]amino]hexanoylamino]-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]hexanoic acid.
| Compound Name | 6-[6-[[2-(2,4-dichlorophenoxy)acetyl]amino]hexanoylamino]-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 68958422 |
| Molecular Formula | C35H39Cl2N3O7 |
| Molecular Weight | 684.62 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | 6-[6-[[2-(2,4-dichlorophenoxy)acetyl]amino]hexanoylamino]-2-[9H-fluoren-9-yl(methoxycarbonyl)amino]hexanoic acid |
| SMILES | COC(=O)N(C(CCCCNC(=O)CCCCCNC(=O)COc1ccc(Cl)cc1Cl)C(=O)O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C35H39Cl2N3O7/c1-46-35(45)40(33-26-13-6-4-11-24(26)25-12-5-7-14-27(25)33)29(34(43)44)15-8-10-20-38-31(41)16-3-2-9-19-39-32(42)22-47-30-18-17-23(36)21-28(30)37/h4-7,11-14,17-18,21,29,33H,2-3,8-10,15-16,19-20,22H2,1H3,(H,38,41)(H,39,42)(H,43,44) |
| InChIKey | ANRLYLJHRUSLPM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|