C39H34N2O5 — CID 44593788
(3S)-5-(N-benzhydrylanilino)-3-[9H-fluoren-9-yl(methoxycarbonyl)amino]-5-oxopentanoic acid (PubChem CID 44593788) has the molecular formula C39H34N2O5 and a molecular weight of 610.71 g/mol. Its IUPAC name is (3S)-5-(N-benzhydrylanilino)-3-[9H-fluoren-9-yl(methoxycarbonyl)amino]-5-oxopentanoic acid.
| Compound Name | (3S)-5-(N-benzhydrylanilino)-3-[9H-fluoren-9-yl(methoxycarbonyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 44593788 |
| Molecular Formula | C39H34N2O5 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | (3S)-5-(N-benzhydrylanilino)-3-[9H-fluoren-9-yl(methoxycarbonyl)amino]-5-oxopentanoic acid |
| SMILES | COC(=O)N(C1c2ccccc2-c2ccccc21)[C@H](CC(=O)O)CC(=O)N(c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H34N2O5/c1-46-39(45)41(38-33-23-13-11-21-31(33)32-22-12-14-24-34(32)38)30(26-36(43)44)25-35(42)40(29-19-9-4-10-20-29)37(27-15-5-2-6-16-27)28-17-7-3-8-18-28/h2-24,30,37-38H,25-26H2,1H3,(H,43,44)/t30-/m0/s1 |
| InChIKey | QVDJQEVXTUGDEC-PMERELPUSA-N |
| XLogP | 7.88 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |