About 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate
8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate (PubChem CID 69298741) has the molecular formula C30H37NO6
and a molecular weight of 507.63 g/mol. Its IUPAC name is 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate.
Molecular Properties
| Compound Name | 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate |
| PubChem CID | 69298741 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate |
| SMILES | C=CCOC(=O)C(CCCCCC(=O)OC(C)(C)C)N(C(=O)OC)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C30H37NO6/c1-6-20-36-28(33)25(18-8-7-9-19-26(32)37-30(2,3)4)31(29(34)35-5)27-23-16-12-10-14-21(23)22-15-11-13-17-24(22)27/h6,10-17,25,27H,1,7-9,18-20H2,2-5H3 |
| InChIKey | XPWKFCRYQQXFJQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate?
The IUPAC name of 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate (CID 69298741) is 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate.
What is the SMILES notation for 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate?
The canonical SMILES for 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate is C=CCOC(=O)C(CCCCCC(=O)OC(C)(C)C)N(C(=O)OC)C1c2ccccc2-c2ccccc21.
What is the InChIKey of 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate?
The InChIKey is XPWKFCRYQQXFJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H37NO6/c1-6-20-36-28(33)25(18-8-7-9-19-26(32)37-30(2,3)4)31(29(34)35-5)27-23-16-12-10-14-21(23)22-15-11-13-17-24(22)27/h6,10-17,25,27H,1,7-9,18-20H2,2-5H3.
What are the key properties of 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate?
8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate has a molecular weight of 507.63 g/mol, XLogP of 6.21, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-O-tert-butyl 1-O-prop-2-enyl 2-[9H-fluoren-9-yl(methoxycarbonyl)amino]octanedioate is sourced from PubChem (CID 69298741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).