C28H33NO6 — CID 155135673
1-O-tert-butyl 4-O-prop-2-enyl (2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]butanedioate (PubChem CID 155135673) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-prop-2-enyl (2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]butanedioate.
| Compound Name | 1-O-tert-butyl 4-O-prop-2-enyl (2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]butanedioate |
|---|---|
| PubChem CID | 155135673 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 1-O-tert-butyl 4-O-prop-2-enyl (2S)-2-[ethyl(9H-fluoren-9-ylmethoxycarbonyl)amino]butanedioate |
| SMILES | C=CCOC(=O)C[C@@H](C(=O)OC(C)(C)C)N(CC)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H33NO6/c1-6-16-33-25(30)17-24(26(31)35-28(3,4)5)29(7-2)27(32)34-18-23-21-14-10-8-12-19(21)20-13-9-11-15-22(20)23/h6,8-15,23-24H,1,7,16-18H2,2-5H3/t24-/m0/s1 |
| InChIKey | LDUYMCVNBGGIEM-DEOSSOPVSA-N |
| XLogP | 5.09 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|