C26H30N2O5 — CID 164550283
prop-2-enyl 2-[[(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoyl]amino]acetate (PubChem CID 164550283) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is prop-2-enyl 2-[[(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoyl]amino]acetate.
| Compound Name | prop-2-enyl 2-[[(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoyl]amino]acetate |
|---|---|
| PubChem CID | 164550283 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | prop-2-enyl 2-[[(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-methylbutanoyl]amino]acetate |
| SMILES | C=CCOC(=O)CNC(=O)[C@H](C(C)C)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H30N2O5/c1-5-14-32-23(29)15-27-25(30)24(17(2)3)28(4)26(31)33-16-22-20-12-8-6-10-18(20)19-11-7-9-13-21(19)22/h5-13,17,22,24H,1,14-16H2,2-4H3,(H,27,30)/t24-/m0/s1 |
| InChIKey | VDGAOEZLNBHGSH-DEOSSOPVSA-N |
| XLogP | 3.74 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|