C27H29NO2 — CID 139191551
methyl (2S)-2-[(R)-(dibenzylamino)-phenylmethyl]pent-4-enoate (PubChem CID 139191551) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is methyl (2S)-2-[(R)-(dibenzylamino)-phenylmethyl]pent-4-enoate.
| Compound Name | methyl (2S)-2-[(R)-(dibenzylamino)-phenylmethyl]pent-4-enoate |
|---|---|
| PubChem CID | 139191551 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | methyl (2S)-2-[(R)-(dibenzylamino)-phenylmethyl]pent-4-enoate |
| SMILES | C=CC[C@H](C(=O)OC)[C@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H29NO2/c1-3-13-25(27(29)30-2)26(24-18-11-6-12-19-24)28(20-22-14-7-4-8-15-22)21-23-16-9-5-10-17-23/h3-12,14-19,25-26H,1,13,20-21H2,2H3/t25-,26-/m0/s1 |
| InChIKey | NKXHLIOWUITOFY-UIOOFZCWSA-N |
| XLogP | 5.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|