C16H21NO3 — CID 10660019
methyl (2S)-2-[(1S)-1-[(2-phenylacetyl)amino]ethyl]pent-4-enoate (PubChem CID 10660019) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl (2S)-2-[(1S)-1-[(2-phenylacetyl)amino]ethyl]pent-4-enoate.
| Compound Name | methyl (2S)-2-[(1S)-1-[(2-phenylacetyl)amino]ethyl]pent-4-enoate |
|---|---|
| PubChem CID | 10660019 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl (2S)-2-[(1S)-1-[(2-phenylacetyl)amino]ethyl]pent-4-enoate |
| SMILES | C=CC[C@H](C(=O)OC)[C@H](C)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-4-8-14(16(19)20-3)12(2)17-15(18)11-13-9-6-5-7-10-13/h4-7,9-10,12,14H,1,8,11H2,2-3H3,(H,17,18)/t12-,14-/m0/s1 |
| InChIKey | RQCGZMAXBZGIKV-JSGCOSHPSA-N |
| XLogP | 2.10 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|