C21H29NO5 — CID 70153736
3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid (PubChem CID 70153736) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is 3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid.
| Compound Name | 3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid |
|---|---|
| PubChem CID | 70153736 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | 3-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl]-5-methyl-2-prop-2-enylhexanoic acid |
| SMILES | C=CCC(C(=O)O)C(CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C21H29NO5/c1-5-9-16(20(24)25)17(12-14(2)3)19(23)22-18(21(26)27-4)13-15-10-7-6-8-11-15/h5-8,10-11,14,16-18H,1,9,12-13H2,2-4H3,(H,22,23)(H,24,25)/t16?,17?,18-/m0/s1 |
| InChIKey | JJLRMADYERPFIE-ABHNRTSZSA-N |
| XLogP | 2.83 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|