C28H39NO2S — CID 143072881
ethane;ethene;methyl 2-(dibenzylamino)-3-[(2E,4Z)-hexa-2,4-dien-2-yl]sulfanylpropanoate (PubChem CID 143072881) has the molecular formula C28H39NO2S and a molecular weight of 453.69 g/mol. Its IUPAC name is ethane;ethene;methyl 2-(dibenzylamino)-3-[(2E,4Z)-hexa-2,4-dien-2-yl]sulfanylpropanoate.
| Compound Name | ethane;ethene;methyl 2-(dibenzylamino)-3-[(2E,4Z)-hexa-2,4-dien-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 143072881 |
| Molecular Formula | C28H39NO2S |
| Molecular Weight | 453.69 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | ethane;ethene;methyl 2-(dibenzylamino)-3-[(2E,4Z)-hexa-2,4-dien-2-yl]sulfanylpropanoate |
| SMILES | C/C=C\C=C(/C)SCC(C(=O)OC)N(Cc1ccccc1)Cc1ccccc1.C=C.CC |
| InChI | InChI=1S/C24H29NO2S.C2H6.C2H4/c1-4-5-12-20(2)28-19-23(24(26)27-3)25(17-21-13-8-6-9-14-21)18-22-15-10-7-11-16-22;2*1-2/h4-16,23H,17-19H2,1-3H3;1-2H3;1-2H2/b5-4-,20-12+;; |
| InChIKey | FZLWGARPHGHRJW-CRHXPBSCSA-N |
| XLogP | 7.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.69 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|