C42H49NO6 — CID 10532417
4-O-tert-butyl 1-O-methyl (2R)-3-[(2S)-2-(dibenzylamino)-3-(4-phenylmethoxyphenyl)propanoyl]-2-propylbutanedioate (PubChem CID 10532417) has the molecular formula C42H49NO6 and a molecular weight of 663.86 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-methyl (2R)-3-[(2S)-2-(dibenzylamino)-3-(4-phenylmethoxyphenyl)propanoyl]-2-propylbutanedioate.
| Compound Name | 4-O-tert-butyl 1-O-methyl (2R)-3-[(2S)-2-(dibenzylamino)-3-(4-phenylmethoxyphenyl)propanoyl]-2-propylbutanedioate |
|---|---|
| PubChem CID | 10532417 |
| Molecular Formula | C42H49NO6 |
| Molecular Weight | 663.86 g/mol |
| Exact Mass | 663.36 |
| IUPAC Name | 4-O-tert-butyl 1-O-methyl (2R)-3-[(2S)-2-(dibenzylamino)-3-(4-phenylmethoxyphenyl)propanoyl]-2-propylbutanedioate |
| SMILES | CCC[C@@H](C(=O)OC)C(C(=O)OC(C)(C)C)C(=O)[C@H](Cc1ccc(OCc2ccccc2)cc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C42H49NO6/c1-6-16-36(40(45)47-5)38(41(46)49-42(2,3)4)39(44)37(27-31-23-25-35(26-24-31)48-30-34-21-14-9-15-22-34)43(28-32-17-10-7-11-18-32)29-33-19-12-8-13-20-33/h7-15,17-26,36-38H,6,16,27-30H2,1-5H3/t36-,37+,38?/m1/s1 |
| InChIKey | DGCJRLSVHJIZJB-MZBIMYFUSA-N |
| XLogP | 8.00 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.86 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|