C20H30O4 — CID 91373541
3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-6,10-dimethylundec-8-en-2-one (PubChem CID 91373541) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-6,10-dimethylundec-8-en-2-one.
| Compound Name | 3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-6,10-dimethylundec-8-en-2-one |
|---|---|
| PubChem CID | 91373541 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-6,10-dimethylundec-8-en-2-one |
| SMILES | COc1cc(CC(=O)C(O)CCC(C)CC=CC(C)C)ccc1O |
| InChI | InChI=1S/C20H30O4/c1-14(2)6-5-7-15(3)8-10-17(21)19(23)12-16-9-11-18(22)20(13-16)24-4/h5-6,9,11,13-15,17,21-22H,7-8,10,12H2,1-4H3 |
| InChIKey | RGWWQUHGGPDGEF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|