About 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol
2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol (PubChem CID 118545574) has the molecular formula C31H40O2
and a molecular weight of 444.66 g/mol. Its IUPAC name is 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol.
Molecular Properties
| Compound Name | 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol |
| PubChem CID | 118545574 |
| Molecular Formula | C31H40O2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.30 |
| IUPAC Name | 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol |
| SMILES | CC(C)=CCCc1ccc2c(O)c3ccc(CCCC(C)CCC=C(C)C)cc3c(O)c2c1 |
| InChI | InChI=1S/C31H40O2/c1-21(2)9-6-11-23(5)12-8-14-25-16-18-27-29(20-25)31(33)28-19-24(13-7-10-22(3)4)15-17-26(28)30(27)32/h9-10,15-20,23,32-33H,6-8,11-14H2,1-5H3 |
| InChIKey | SDKQVBUUSGZVCP-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol?
The IUPAC name of 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol (CID 118545574) is 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol.
What is the SMILES notation for 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol?
The canonical SMILES for 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol is CC(C)=CCCc1ccc2c(O)c3ccc(CCCC(C)CCC=C(C)C)cc3c(O)c2c1.
What is the InChIKey of 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol?
The InChIKey is SDKQVBUUSGZVCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H40O2/c1-21(2)9-6-11-23(5)12-8-14-25-16-18-27-29(20-25)31(33)28-19-24(13-7-10-22(3)4)15-17-26(28)30(27)32/h9-10,15-20,23,32-33H,6-8,11-14H2,1-5H3.
What are the key properties of 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol?
2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol has a molecular weight of 444.66 g/mol, XLogP of 9.01, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,8-dimethylnon-7-enyl)-7-(4-methylpent-3-enyl)anthracene-9,10-diol is sourced from PubChem (CID 118545574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).